C14H25N3O7 — CID 176816953
2-[2-[2-[2-[2-[(1-methyltriazol-4-yl)methoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid (PubChem CID 176816953) has the molecular formula C14H25N3O7 and a molecular weight of 347.37 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[(1-methyltriazol-4-yl)methoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[2-[2-[(1-methyltriazol-4-yl)methoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 176816953 |
| Molecular Formula | C14H25N3O7 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 2-[2-[2-[2-[2-[(1-methyltriazol-4-yl)methoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
| SMILES | Cn1cc(COCCOCCOCCOCCOCC(=O)O)nn1 |
| InChI | InChI=1S/C14H25N3O7/c1-17-10-13(15-16-17)11-23-8-6-21-4-2-20-3-5-22-7-9-24-12-14(18)19/h10H,2-9,11-12H2,1H3,(H,18,19) |
| InChIKey | YLPIOOWXRWZRFB-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 114.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|