C17H26BrNO — CID 107156685
N-(2-bromo-4,4-dimethylpentyl)-3-(2-methylphenyl)propanamide (PubChem CID 107156685) has the molecular formula C17H26BrNO and a molecular weight of 340.31 g/mol. Its IUPAC name is N-(2-bromo-4,4-dimethylpentyl)-3-(2-methylphenyl)propanamide.
| Compound Name | N-(2-bromo-4,4-dimethylpentyl)-3-(2-methylphenyl)propanamide |
|---|---|
| PubChem CID | 107156685 |
| Molecular Formula | C17H26BrNO |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | N-(2-bromo-4,4-dimethylpentyl)-3-(2-methylphenyl)propanamide |
| SMILES | Cc1ccccc1CCC(=O)NCC(Br)CC(C)(C)C |
| InChI | InChI=1S/C17H26BrNO/c1-13-7-5-6-8-14(13)9-10-16(20)19-12-15(18)11-17(2,3)4/h5-8,15H,9-12H2,1-4H3,(H,19,20) |
| InChIKey | RZLPWNQCFFMPBF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|