C10H18N2O3 — CID 139707468
N',N',5,5-tetramethyl-2,4-dioxohexanehydrazide (PubChem CID 139707468) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is N',N',5,5-tetramethyl-2,4-dioxohexanehydrazide.
| Compound Name | N',N',5,5-tetramethyl-2,4-dioxohexanehydrazide |
|---|---|
| PubChem CID | 139707468 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | N',N',5,5-tetramethyl-2,4-dioxohexanehydrazide |
| SMILES | CN(C)NC(=O)C(=O)CC(=O)C(C)(C)C |
| InChI | InChI=1S/C10H18N2O3/c1-10(2,3)8(14)6-7(13)9(15)11-12(4)5/h6H2,1-5H3,(H,11,15) |
| InChIKey | BYQQDAOOLSYXAW-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|