C12H20N2O4 — CID 139707460
5,5-dimethyl-N-morpholin-4-yl-2,4-dioxohexanamide (PubChem CID 139707460) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is 5,5-dimethyl-N-morpholin-4-yl-2,4-dioxohexanamide.
| Compound Name | 5,5-dimethyl-N-morpholin-4-yl-2,4-dioxohexanamide |
|---|---|
| PubChem CID | 139707460 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 5,5-dimethyl-N-morpholin-4-yl-2,4-dioxohexanamide |
| SMILES | CC(C)(C)C(=O)CC(=O)C(=O)NN1CCOCC1 |
| InChI | InChI=1S/C12H20N2O4/c1-12(2,3)10(16)8-9(15)11(17)13-14-4-6-18-7-5-14/h4-8H2,1-3H3,(H,13,17) |
| InChIKey | LFTNTNTVESSPQX-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|