C7H15N3O2 — CID 116657343
1,1-dimethyl-3-morpholin-4-ylurea (PubChem CID 116657343) has the molecular formula C7H15N3O2 and a molecular weight of 173.22 g/mol. Its IUPAC name is 1,1-dimethyl-3-morpholin-4-ylurea.
| Compound Name | 1,1-dimethyl-3-morpholin-4-ylurea |
|---|---|
| PubChem CID | 116657343 |
| Molecular Formula | C7H15N3O2 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 1,1-dimethyl-3-morpholin-4-ylurea |
| SMILES | CN(C)C(=O)NN1CCOCC1 |
| InChI | InChI=1S/C7H15N3O2/c1-9(2)7(11)8-10-3-5-12-6-4-10/h3-6H2,1-2H3,(H,8,11) |
| InChIKey | IDDZAWHPJBJLCM-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |