About morpholin-4-yl N-morpholin-4-ylcarbamate
morpholin-4-yl N-morpholin-4-ylcarbamate (PubChem CID 57465870) has the molecular formula C9H17N3O4
and a molecular weight of 231.25 g/mol. Its IUPAC name is morpholin-4-yl N-morpholin-4-ylcarbamate.
Molecular Properties
| Compound Name | morpholin-4-yl N-morpholin-4-ylcarbamate |
| PubChem CID | 57465870 |
| Molecular Formula | C9H17N3O4 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | morpholin-4-yl N-morpholin-4-ylcarbamate |
| SMILES | O=C(NN1CCOCC1)ON1CCOCC1 |
| InChI | InChI=1S/C9H17N3O4/c13-9(10-11-1-5-14-6-2-11)16-12-3-7-15-8-4-12/h1-8H2,(H,10,13) |
| InChIKey | HXLOMVRJNDBAJV-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze morpholin-4-yl N-morpholin-4-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholin-4-yl N-morpholin-4-ylcarbamate?
The IUPAC name of morpholin-4-yl N-morpholin-4-ylcarbamate (CID 57465870) is morpholin-4-yl N-morpholin-4-ylcarbamate.
What is the SMILES notation for morpholin-4-yl N-morpholin-4-ylcarbamate?
The canonical SMILES for morpholin-4-yl N-morpholin-4-ylcarbamate is O=C(NN1CCOCC1)ON1CCOCC1.
What is the InChIKey of morpholin-4-yl N-morpholin-4-ylcarbamate?
The InChIKey is HXLOMVRJNDBAJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O4/c13-9(10-11-1-5-14-6-2-11)16-12-3-7-15-8-4-12/h1-8H2,(H,10,13).
What are the key properties of morpholin-4-yl N-morpholin-4-ylcarbamate?
morpholin-4-yl N-morpholin-4-ylcarbamate has a molecular weight of 231.25 g/mol, XLogP of -0.79, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for morpholin-4-yl N-morpholin-4-ylcarbamate is sourced from PubChem (CID 57465870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).