About (2-fluorophenyl) N-morpholin-4-ylcarbamate
(2-fluorophenyl) N-morpholin-4-ylcarbamate (PubChem CID 69134552) has the molecular formula C11H13FN2O3
and a molecular weight of 240.23 g/mol. Its IUPAC name is (2-fluorophenyl) N-morpholin-4-ylcarbamate.
Molecular Properties
| Compound Name | (2-fluorophenyl) N-morpholin-4-ylcarbamate |
| PubChem CID | 69134552 |
| Molecular Formula | C11H13FN2O3 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | (2-fluorophenyl) N-morpholin-4-ylcarbamate |
| SMILES | O=C(NN1CCOCC1)Oc1ccccc1F |
| InChI | InChI=1S/C11H13FN2O3/c12-9-3-1-2-4-10(9)17-11(15)13-14-5-7-16-8-6-14/h1-4H,5-8H2,(H,13,15) |
| InChIKey | XHSQKHPOHBMFFE-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-fluorophenyl) N-morpholin-4-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluorophenyl) N-morpholin-4-ylcarbamate?
The IUPAC name of (2-fluorophenyl) N-morpholin-4-ylcarbamate (CID 69134552) is (2-fluorophenyl) N-morpholin-4-ylcarbamate.
What is the SMILES notation for (2-fluorophenyl) N-morpholin-4-ylcarbamate?
The canonical SMILES for (2-fluorophenyl) N-morpholin-4-ylcarbamate is O=C(NN1CCOCC1)Oc1ccccc1F.
What is the InChIKey of (2-fluorophenyl) N-morpholin-4-ylcarbamate?
The InChIKey is XHSQKHPOHBMFFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13FN2O3/c12-9-3-1-2-4-10(9)17-11(15)13-14-5-7-16-8-6-14/h1-4H,5-8H2,(H,13,15).
What are the key properties of (2-fluorophenyl) N-morpholin-4-ylcarbamate?
(2-fluorophenyl) N-morpholin-4-ylcarbamate has a molecular weight of 240.23 g/mol, XLogP of 1.16, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluorophenyl) N-morpholin-4-ylcarbamate is sourced from PubChem (CID 69134552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).