C8H14N2O3 — CID 83003584
4-(2,2-dimethylhydrazinyl)-2,3-dimethyl-4-oxobut-2-enoic acid (PubChem CID 83003584) has the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. Its IUPAC name is 4-(2,2-dimethylhydrazinyl)-2,3-dimethyl-4-oxobut-2-enoic acid.
| Compound Name | 4-(2,2-dimethylhydrazinyl)-2,3-dimethyl-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 83003584 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 4-(2,2-dimethylhydrazinyl)-2,3-dimethyl-4-oxobut-2-enoic acid |
| SMILES | CC(C(=O)O)=C(C)C(=O)NN(C)C |
| InChI | InChI=1S/C8H14N2O3/c1-5(6(2)8(12)13)7(11)9-10(3)4/h1-4H3,(H,9,11)(H,12,13) |
| InChIKey | JFZBQAGBUNAGJT-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|