About S-(methylamino) propanethioate
S-(methylamino) propanethioate (PubChem CID 123915955) has the molecular formula C4H9NOS
and a molecular weight of 119.19 g/mol. Its IUPAC name is S-(methylamino) propanethioate.
Molecular Properties
| Compound Name | S-(methylamino) propanethioate |
| PubChem CID | 123915955 |
| Molecular Formula | C4H9NOS |
| Molecular Weight | 119.19 g/mol |
| Exact Mass | 119.04 |
| IUPAC Name | S-(methylamino) propanethioate |
| SMILES | CCC(=O)SNC |
| InChI | InChI=1S/C4H9NOS/c1-3-4(6)7-5-2/h5H,3H2,1-2H3 |
| InChIKey | MOAOHFUMEOIZKY-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.19 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(methylamino) propanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(methylamino) propanethioate?
The IUPAC name of S-(methylamino) propanethioate (CID 123915955) is S-(methylamino) propanethioate.
What is the SMILES notation for S-(methylamino) propanethioate?
The canonical SMILES for S-(methylamino) propanethioate is CCC(=O)SNC.
What is the InChIKey of S-(methylamino) propanethioate?
The InChIKey is MOAOHFUMEOIZKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NOS/c1-3-4(6)7-5-2/h5H,3H2,1-2H3.
What are the key properties of S-(methylamino) propanethioate?
S-(methylamino) propanethioate has a molecular weight of 119.19 g/mol, XLogP of 0.79, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(methylamino) propanethioate is sourced from PubChem (CID 123915955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).