About S-hydroxy propanethioate
S-hydroxy propanethioate (PubChem CID 173150014) has the molecular formula C3H6O2S
and a molecular weight of 106.15 g/mol. Its IUPAC name is S-hydroxy propanethioate.
Molecular Properties
| Compound Name | S-hydroxy propanethioate |
| PubChem CID | 173150014 |
| Molecular Formula | C3H6O2S |
| Molecular Weight | 106.15 g/mol |
| Exact Mass | 106.01 |
| IUPAC Name | S-hydroxy propanethioate |
| SMILES | CCC(=O)SO |
| InChI | InChI=1S/C3H6O2S/c1-2-3(4)6-5/h5H,2H2,1H3 |
| InChIKey | MBOHKJJVSFHXHW-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.15 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-hydroxy propanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-hydroxy propanethioate?
The IUPAC name of S-hydroxy propanethioate (CID 173150014) is S-hydroxy propanethioate.
What is the SMILES notation for S-hydroxy propanethioate?
The canonical SMILES for S-hydroxy propanethioate is CCC(=O)SO.
What is the InChIKey of S-hydroxy propanethioate?
The InChIKey is MBOHKJJVSFHXHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O2S/c1-2-3(4)6-5/h5H,2H2,1H3.
What are the key properties of S-hydroxy propanethioate?
S-hydroxy propanethioate has a molecular weight of 106.15 g/mol, XLogP of 1.13, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-hydroxy propanethioate is sourced from PubChem (CID 173150014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).