About acetic acid;sulfanediol
acetic acid;sulfanediol (PubChem CID 87083890) has the molecular formula C2H6O4S
and a molecular weight of 126.13 g/mol. Its IUPAC name is acetic acid;sulfanediol.
Molecular Properties
| Compound Name | acetic acid;sulfanediol |
| PubChem CID | 87083890 |
| Molecular Formula | C2H6O4S |
| Molecular Weight | 126.13 g/mol |
| Exact Mass | 126.00 |
| IUPAC Name | acetic acid;sulfanediol |
| SMILES | CC(=O)O.OSO |
| InChI | InChI=1S/C2H4O2.H2O2S/c1-2(3)4;1-3-2/h1H3,(H,3,4);1-2H |
| InChIKey | WJVJATRFZRFLEG-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.13 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;sulfanediol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;sulfanediol?
The IUPAC name of acetic acid;sulfanediol (CID 87083890) is acetic acid;sulfanediol.
What is the SMILES notation for acetic acid;sulfanediol?
The canonical SMILES for acetic acid;sulfanediol is CC(=O)O.OSO.
What is the InChIKey of acetic acid;sulfanediol?
The InChIKey is WJVJATRFZRFLEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O2.H2O2S/c1-2(3)4;1-3-2/h1H3,(H,3,4);1-2H.
What are the key properties of acetic acid;sulfanediol?
acetic acid;sulfanediol has a molecular weight of 126.13 g/mol, XLogP of 0.76, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;sulfanediol is sourced from PubChem (CID 87083890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).