C10H22N2O — CID 90814262
3-(dipropylamino)-N-methylpropanamide (PubChem CID 90814262) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is 3-(dipropylamino)-N-methylpropanamide.
| Compound Name | 3-(dipropylamino)-N-methylpropanamide |
|---|---|
| PubChem CID | 90814262 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 3-(dipropylamino)-N-methylpropanamide |
| SMILES | CCCN(CCC)CCC(=O)NC |
| InChI | InChI=1S/C10H22N2O/c1-4-7-12(8-5-2)9-6-10(13)11-3/h4-9H2,1-3H3,(H,11,13) |
| InChIKey | FROLLSVLGBBQIF-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |