C15H32N4O2 — CID 118657481
3-[2-[2-aminoethyl(3-oxobutyl)amino]ethyl-propylamino]-N-methylpropanamide (PubChem CID 118657481) has the molecular formula C15H32N4O2 and a molecular weight of 300.45 g/mol. Its IUPAC name is 3-[2-[2-aminoethyl(3-oxobutyl)amino]ethyl-propylamino]-N-methylpropanamide.
| Compound Name | 3-[2-[2-aminoethyl(3-oxobutyl)amino]ethyl-propylamino]-N-methylpropanamide |
|---|---|
| PubChem CID | 118657481 |
| Molecular Formula | C15H32N4O2 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | 3-[2-[2-aminoethyl(3-oxobutyl)amino]ethyl-propylamino]-N-methylpropanamide |
| SMILES | CCCN(CCC(=O)NC)CCN(CCN)CCC(C)=O |
| InChI | InChI=1S/C15H32N4O2/c1-4-8-18(10-6-15(21)17-3)12-13-19(11-7-16)9-5-14(2)20/h4-13,16H2,1-3H3,(H,17,21) |
| InChIKey | GKYYLNDWIDHCDR-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |