C20H41N5O3 — CID 58105394
6-[5-[bis[3-(methylamino)-3-oxopropyl]amino]pentylamino]-N-methylhexanamide (PubChem CID 58105394) has the molecular formula C20H41N5O3 and a molecular weight of 399.58 g/mol. Its IUPAC name is 6-[5-[bis[3-(methylamino)-3-oxopropyl]amino]pentylamino]-N-methylhexanamide.
| Compound Name | 6-[5-[bis[3-(methylamino)-3-oxopropyl]amino]pentylamino]-N-methylhexanamide |
|---|---|
| PubChem CID | 58105394 |
| Molecular Formula | C20H41N5O3 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.32 |
| IUPAC Name | 6-[5-[bis[3-(methylamino)-3-oxopropyl]amino]pentylamino]-N-methylhexanamide |
| SMILES | CNC(=O)CCCCCNCCCCCN(CCC(=O)NC)CCC(=O)NC |
| InChI | InChI=1S/C20H41N5O3/c1-21-18(26)10-6-4-7-13-24-14-8-5-9-15-25(16-11-19(27)22-2)17-12-20(28)23-3/h24H,4-17H2,1-3H3,(H,21,26)(H,22,27)(H,23,28) |
| InChIKey | OMLSGHFEHIVGRY-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 102.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|