C15H33N5O2 — CID 58105591
3-[2-[5-aminopentyl-[3-(methylamino)-3-oxopropyl]amino]ethylamino]-N-methylpropanamide (PubChem CID 58105591) has the molecular formula C15H33N5O2 and a molecular weight of 315.46 g/mol. Its IUPAC name is 3-[2-[5-aminopentyl-[3-(methylamino)-3-oxopropyl]amino]ethylamino]-N-methylpropanamide.
| Compound Name | 3-[2-[5-aminopentyl-[3-(methylamino)-3-oxopropyl]amino]ethylamino]-N-methylpropanamide |
|---|---|
| PubChem CID | 58105591 |
| Molecular Formula | C15H33N5O2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.26 |
| IUPAC Name | 3-[2-[5-aminopentyl-[3-(methylamino)-3-oxopropyl]amino]ethylamino]-N-methylpropanamide |
| SMILES | CNC(=O)CCNCCN(CCCCCN)CCC(=O)NC |
| InChI | InChI=1S/C15H33N5O2/c1-17-14(21)6-9-19-10-13-20(11-5-3-4-8-16)12-7-15(22)18-2/h19H,3-13,16H2,1-2H3,(H,17,21)(H,18,22) |
| InChIKey | MLTSSJXKRDSUJR-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|