C16H36N6O2 — CID 71362529
3-[4-aminobutyl-[3-(3-aminopropylamino)-3-oxopropyl]amino]-N-(3-aminopropyl)propanamide (PubChem CID 71362529) has the molecular formula C16H36N6O2 and a molecular weight of 344.50 g/mol. Its IUPAC name is 3-[4-aminobutyl-[3-(3-aminopropylamino)-3-oxopropyl]amino]-N-(3-aminopropyl)propanamide.
| Compound Name | 3-[4-aminobutyl-[3-(3-aminopropylamino)-3-oxopropyl]amino]-N-(3-aminopropyl)propanamide |
|---|---|
| PubChem CID | 71362529 |
| Molecular Formula | C16H36N6O2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.29 |
| IUPAC Name | 3-[4-aminobutyl-[3-(3-aminopropylamino)-3-oxopropyl]amino]-N-(3-aminopropyl)propanamide |
| SMILES | NCCCCN(CCC(=O)NCCCN)CCC(=O)NCCCN |
| InChI | InChI=1S/C16H36N6O2/c17-7-1-2-12-22(13-5-15(23)20-10-3-8-18)14-6-16(24)21-11-4-9-19/h1-14,17-19H2,(H,20,23)(H,21,24) |
| InChIKey | ADQAQCJGSZAUHQ-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 139.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|