C14H31N5O3 — CID 172946431
N-(3-aminopropyl)-3-[[3-(3-aminopropylamino)-3-oxopropyl]-(2-hydroxyethyl)amino]propanamide (PubChem CID 172946431) has the molecular formula C14H31N5O3 and a molecular weight of 317.43 g/mol. Its IUPAC name is N-(3-aminopropyl)-3-[[3-(3-aminopropylamino)-3-oxopropyl]-(2-hydroxyethyl)amino]propanamide.
| Compound Name | N-(3-aminopropyl)-3-[[3-(3-aminopropylamino)-3-oxopropyl]-(2-hydroxyethyl)amino]propanamide |
|---|---|
| PubChem CID | 172946431 |
| Molecular Formula | C14H31N5O3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | N-(3-aminopropyl)-3-[[3-(3-aminopropylamino)-3-oxopropyl]-(2-hydroxyethyl)amino]propanamide |
| SMILES | NCCCNC(=O)CCN(CCO)CCC(=O)NCCCN |
| InChI | InChI=1S/C14H31N5O3/c15-5-1-7-17-13(21)3-9-19(11-12-20)10-4-14(22)18-8-2-6-16/h20H,1-12,15-16H2,(H,17,21)(H,18,22) |
| InChIKey | HNIUADGSPCZIIS-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 133.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|