C16H35N7O3 — CID 118288521
N-(3-aminopropyl)-3-[bis[3-(2-aminoethylamino)-3-oxopropyl]amino]propanamide (PubChem CID 118288521) has the molecular formula C16H35N7O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is N-(3-aminopropyl)-3-[bis[3-(2-aminoethylamino)-3-oxopropyl]amino]propanamide.
| Compound Name | N-(3-aminopropyl)-3-[bis[3-(2-aminoethylamino)-3-oxopropyl]amino]propanamide |
|---|---|
| PubChem CID | 118288521 |
| Molecular Formula | C16H35N7O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.28 |
| IUPAC Name | N-(3-aminopropyl)-3-[bis[3-(2-aminoethylamino)-3-oxopropyl]amino]propanamide |
| SMILES | NCCCNC(=O)CCN(CCC(=O)NCCN)CCC(=O)NCCN |
| InChI | InChI=1S/C16H35N7O3/c17-5-1-8-20-14(24)2-11-23(12-3-15(25)21-9-6-18)13-4-16(26)22-10-7-19/h1-13,17-19H2,(H,20,24)(H,21,25)(H,22,26) |
| InChIKey | CQMGSDTVISVZFA-UHFFFAOYSA-N |
| XLogP | -2.93 |
| TPSA | 168.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|