C15H35N5O2Si — CID 71427849
N-(2-aminoethyl)-3-[[3-(2-aminoethylamino)-3-oxopropyl]-(3-dimethylsilylpropyl)amino]propanamide (PubChem CID 71427849) has the molecular formula C15H35N5O2Si and a molecular weight of 345.56 g/mol. Its IUPAC name is N-(2-aminoethyl)-3-[[3-(2-aminoethylamino)-3-oxopropyl]-(3-dimethylsilylpropyl)amino]propanamide.
| Compound Name | N-(2-aminoethyl)-3-[[3-(2-aminoethylamino)-3-oxopropyl]-(3-dimethylsilylpropyl)amino]propanamide |
|---|---|
| PubChem CID | 71427849 |
| Molecular Formula | C15H35N5O2Si |
| Molecular Weight | 345.56 g/mol |
| Exact Mass | 345.26 |
| IUPAC Name | N-(2-aminoethyl)-3-[[3-(2-aminoethylamino)-3-oxopropyl]-(3-dimethylsilylpropyl)amino]propanamide |
| SMILES | C[SiH](C)CCCN(CCC(=O)NCCN)CCC(=O)NCCN |
| InChI | InChI=1S/C15H35N5O2Si/c1-23(2)13-3-10-20(11-4-14(21)18-8-6-16)12-5-15(22)19-9-7-17/h23H,3-13,16-17H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | ACIJANKDGVQKKN-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.56 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|