ethoxy-[3-[(2,2,2-trifluoroacetyl)amino]propyl]phosphinic acid

C7H13F3NO4P — CID 59131645

IUPACethoxy-[3-[(2,2,2-trifluoroacetyl)amino]propyl]phosphinic acid
SMILESCCOP(=O)(O)CCCNC(=O)C(F)(F)F
InChIInChI=1S/C7H13F3NO4P/c1-2-15-16(13,14)5-3-4-11-6(12)7(8,9)10/h2-5H2,1H3,(H,11,12)(H,13,14)
InChIKeyXYTXTWQCDQIRNL-UHFFFAOYSA-N
MW263.15 g/mol
LogP1.28
Rot. Bonds6

About ethoxy-[3-[(2,2,2-trifluoroacetyl)amino]propyl]phosphinic acid

ethoxy-[3-[(2,2,2-trifluoroacetyl)amino]propyl]phosphinic acid (PubChem CID 59131645) has the molecular formula C7H13F3NO4P and a molecular weight of 263.15 g/mol. Its IUPAC name is ethoxy-[3-[(2,2,2-trifluoroacetyl)amino]propyl]phosphinic acid.

Molecular Properties

Compound Nameethoxy-[3-[(2,2,2-trifluoroacetyl)amino]propyl]phosphinic acid
PubChem CID59131645
Molecular FormulaC7H13F3NO4P
Molecular Weight263.15 g/mol
Exact Mass263.05
IUPAC Nameethoxy-[3-[(2,2,2-trifluoroacetyl)amino]propyl]phosphinic acid
SMILESCCOP(=O)(O)CCCNC(=O)C(F)(F)F
InChIInChI=1S/C7H13F3NO4P/c1-2-15-16(13,14)5-3-4-11-6(12)7(8,9)10/h2-5H2,1H3,(H,11,12)(H,13,14)
InChIKeyXYTXTWQCDQIRNL-UHFFFAOYSA-N
XLogP1.28
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.15
LogP ≤ 51.28
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze ethoxy-[3-[(2,2,2-trifluoroacetyl)amino]propyl]phosphinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethoxy-[3-[(2,2,2-trifluoroacetyl)amino]propyl]phosphinic acid?
The IUPAC name of ethoxy-[3-[(2,2,2-trifluoroacetyl)amino]propyl]phosphinic acid (CID 59131645) is ethoxy-[3-[(2,2,2-trifluoroacetyl)amino]propyl]phosphinic acid.
What is the SMILES notation for ethoxy-[3-[(2,2,2-trifluoroacetyl)amino]propyl]phosphinic acid?
The canonical SMILES for ethoxy-[3-[(2,2,2-trifluoroacetyl)amino]propyl]phosphinic acid is CCOP(=O)(O)CCCNC(=O)C(F)(F)F.
What is the InChIKey of ethoxy-[3-[(2,2,2-trifluoroacetyl)amino]propyl]phosphinic acid?
The InChIKey is XYTXTWQCDQIRNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13F3NO4P/c1-2-15-16(13,14)5-3-4-11-6(12)7(8,9)10/h2-5H2,1H3,(H,11,12)(H,13,14).
What are the key properties of ethoxy-[3-[(2,2,2-trifluoroacetyl)amino]propyl]phosphinic acid?
ethoxy-[3-[(2,2,2-trifluoroacetyl)amino]propyl]phosphinic acid has a molecular weight of 263.15 g/mol, XLogP of 1.28, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxy-[3-[(2,2,2-trifluoroacetyl)amino]propyl]phosphinic acid is sourced from PubChem (CID 59131645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).