C18H41F3N3O5P — CID 140602645
bis(triethylazanium);4-[(2,2,2-trifluoroacetyl)amino]butyl phosphate (PubChem CID 140602645) has the molecular formula C18H41F3N3O5P and a molecular weight of 467.51 g/mol. Its IUPAC name is bis(triethylazanium);4-[(2,2,2-trifluoroacetyl)amino]butyl phosphate.
| Compound Name | bis(triethylazanium);4-[(2,2,2-trifluoroacetyl)amino]butyl phosphate |
|---|---|
| PubChem CID | 140602645 |
| Molecular Formula | C18H41F3N3O5P |
| Molecular Weight | 467.51 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | bis(triethylazanium);4-[(2,2,2-trifluoroacetyl)amino]butyl phosphate |
| SMILES | CC[NH+](CC)CC.CC[NH+](CC)CC.O=C(NCCCCOP(=O)([O-])[O-])C(F)(F)F |
| InChI | InChI=1S/C6H11F3NO5P.2C6H15N/c7-6(8,9)5(11)10-3-1-2-4-15-16(12,13)14;2*1-4-7(5-2)6-3/h1-4H2,(H,10,11)(H2,12,13,14);2*4-6H2,1-3H3 |
| InChIKey | KBRVEKAYCLBSDB-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 110.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.51 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|