C14H28F6N4O3 — CID 159986318
ethyl 2,2,2-trifluoroacetate;N'-methylpropane-1,3-diamine;2,2,2-trifluoro-N-[3-(methylamino)propyl]acetamide (PubChem CID 159986318) has the molecular formula C14H28F6N4O3 and a molecular weight of 414.39 g/mol. Its IUPAC name is ethyl 2,2,2-trifluoroacetate;N'-methylpropane-1,3-diamine;2,2,2-trifluoro-N-[3-(methylamino)propyl]acetamide.
| Compound Name | ethyl 2,2,2-trifluoroacetate;N'-methylpropane-1,3-diamine;2,2,2-trifluoro-N-[3-(methylamino)propyl]acetamide |
|---|---|
| PubChem CID | 159986318 |
| Molecular Formula | C14H28F6N4O3 |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | ethyl 2,2,2-trifluoroacetate;N'-methylpropane-1,3-diamine;2,2,2-trifluoro-N-[3-(methylamino)propyl]acetamide |
| SMILES | CCOC(=O)C(F)(F)F.CNCCCN.CNCCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C6H11F3N2O.C4H5F3O2.C4H12N2/c1-10-3-2-4-11-5(12)6(7,8)9;1-2-9-3(8)4(5,6)7;1-6-4-2-3-5/h10H,2-4H2,1H3,(H,11,12);2H2,1H3;6H,2-5H2,1H3 |
| InChIKey | OGJNHTXQXWSBSI-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|