C13H28NO9P — CID 175835823
2-[3-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]propanoylamino]ethyl dihydrogen phosphate (PubChem CID 175835823) has the molecular formula C13H28NO9P and a molecular weight of 373.34 g/mol. Its IUPAC name is 2-[3-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]propanoylamino]ethyl dihydrogen phosphate.
| Compound Name | 2-[3-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]propanoylamino]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 175835823 |
| Molecular Formula | C13H28NO9P |
| Molecular Weight | 373.34 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 2-[3-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]propanoylamino]ethyl dihydrogen phosphate |
| SMILES | CCOCCOCCOCCOCCC(=O)NCCOP(=O)(O)O |
| InChI | InChI=1S/C13H28NO9P/c1-2-19-7-8-21-11-12-22-10-9-20-5-3-13(15)14-4-6-23-24(16,17)18/h2-12H2,1H3,(H,14,15)(H2,16,17,18) |
| InChIKey | YRBYDXFZMIOSSB-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 132.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.34 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|