C13H23F3N2O5 — CID 134433312
tert-butyl N-[2-(2-hydroxyethoxy)ethyl]-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]carbamate (PubChem CID 134433312) has the molecular formula C13H23F3N2O5 and a molecular weight of 344.33 g/mol. Its IUPAC name is tert-butyl N-[2-(2-hydroxyethoxy)ethyl]-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(2-hydroxyethoxy)ethyl]-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 134433312 |
| Molecular Formula | C13H23F3N2O5 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | tert-butyl N-[2-(2-hydroxyethoxy)ethyl]-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCNC(=O)C(F)(F)F)CCOCCO |
| InChI | InChI=1S/C13H23F3N2O5/c1-12(2,3)23-11(21)18(6-8-22-9-7-19)5-4-17-10(20)13(14,15)16/h19H,4-9H2,1-3H3,(H,17,20) |
| InChIKey | WHHFFGJDKSUJEI-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|