C17H36N2O6 — CID 175415443
tert-butyl N-[2-[2-[2-(ethylamino)ethoxy]ethoxy]ethyl]-N-[2-(2-hydroxyethoxy)ethyl]carbamate (PubChem CID 175415443) has the molecular formula C17H36N2O6 and a molecular weight of 364.48 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-(ethylamino)ethoxy]ethoxy]ethyl]-N-[2-(2-hydroxyethoxy)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-(ethylamino)ethoxy]ethoxy]ethyl]-N-[2-(2-hydroxyethoxy)ethyl]carbamate |
|---|---|
| PubChem CID | 175415443 |
| Molecular Formula | C17H36N2O6 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | tert-butyl N-[2-[2-[2-(ethylamino)ethoxy]ethoxy]ethyl]-N-[2-(2-hydroxyethoxy)ethyl]carbamate |
| SMILES | CCNCCOCCOCCN(CCOCCO)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H36N2O6/c1-5-18-6-10-22-14-15-24-12-8-19(7-11-23-13-9-20)16(21)25-17(2,3)4/h18,20H,5-15H2,1-4H3 |
| InChIKey | ZUVNEGDXOPYKHJ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|