C13H17BrN2O4 — CID 35604980
2-[(6-bromo-1,3-benzodioxol-5-yl)methylamino]-N-(2-methoxyethyl)acetamide (PubChem CID 35604980) has the molecular formula C13H17BrN2O4 and a molecular weight of 345.19 g/mol. Its IUPAC name is 2-[(6-bromo-1,3-benzodioxol-5-yl)methylamino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(6-bromo-1,3-benzodioxol-5-yl)methylamino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 35604980 |
| Molecular Formula | C13H17BrN2O4 |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 2-[(6-bromo-1,3-benzodioxol-5-yl)methylamino]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CNCc1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C13H17BrN2O4/c1-18-3-2-16-13(17)7-15-6-9-4-11-12(5-10(9)14)20-8-19-11/h4-5,15H,2-3,6-8H2,1H3,(H,16,17) |
| InChIKey | NSFPOURPXLYYRW-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|