C14H21BrN2O3 — CID 62843610
N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine (PubChem CID 62843610) has the molecular formula C14H21BrN2O3 and a molecular weight of 345.24 g/mol. Its IUPAC name is N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine.
| Compound Name | N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 62843610 |
| Molecular Formula | C14H21BrN2O3 |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine |
| SMILES | COCCN(C)CCNCc1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C14H21BrN2O3/c1-17(5-6-18-2)4-3-16-9-11-7-13-14(8-12(11)15)20-10-19-13/h7-8,16H,3-6,9-10H2,1-2H3 |
| InChIKey | LHFWCNIDMLXADU-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|