C15H17F2NOS — CID 103081163
2-(2,2-difluoroethoxy)-N-[(4-phenylthiophen-2-yl)methyl]ethanamine (PubChem CID 103081163) has the molecular formula C15H17F2NOS and a molecular weight of 297.37 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)-N-[(4-phenylthiophen-2-yl)methyl]ethanamine.
| Compound Name | 2-(2,2-difluoroethoxy)-N-[(4-phenylthiophen-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 103081163 |
| Molecular Formula | C15H17F2NOS |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 2-(2,2-difluoroethoxy)-N-[(4-phenylthiophen-2-yl)methyl]ethanamine |
| SMILES | FC(F)COCCNCc1cc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C15H17F2NOS/c16-15(17)10-19-7-6-18-9-14-8-13(11-20-14)12-4-2-1-3-5-12/h1-5,8,11,15,18H,6-7,9-10H2 |
| InChIKey | GIHCTWLZKTXTAF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|