C19H30ClN4O5P — CID 91318728
tert-butyl N-(2-amino-3-phosphanyloxypropyl)carbamate;4-chloro-3-nitroquinoline;ethane (PubChem CID 91318728) has the molecular formula C19H30ClN4O5P and a molecular weight of 460.90 g/mol. Its IUPAC name is tert-butyl N-(2-amino-3-phosphanyloxypropyl)carbamate;4-chloro-3-nitroquinoline;ethane.
| Compound Name | tert-butyl N-(2-amino-3-phosphanyloxypropyl)carbamate;4-chloro-3-nitroquinoline;ethane |
|---|---|
| PubChem CID | 91318728 |
| Molecular Formula | C19H30ClN4O5P |
| Molecular Weight | 460.90 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | tert-butyl N-(2-amino-3-phosphanyloxypropyl)carbamate;4-chloro-3-nitroquinoline;ethane |
| SMILES | CC.CC(C)(C)OC(=O)NCC(N)COP.O=[N+]([O-])c1cnc2ccccc2c1Cl |
| InChI | InChI=1S/C9H5ClN2O2.C8H19N2O3P.C2H6/c10-9-6-3-1-2-4-7(6)11-5-8(9)12(13)14;1-8(2,3)13-7(11)10-4-6(9)5-12-14;1-2/h1-5H;6H,4-5,9,14H2,1-3H3,(H,10,11);1-2H3 |
| InChIKey | RETGKBBKRLRDTM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 129.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.90 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|