C14H22Cl2N4O2 — CID 46915218
tert-butyl N-[[2-chloro-5-(chloromethyl)pyrimidin-4-yl]-(2-methylpropyl)amino]carbamate (PubChem CID 46915218) has the molecular formula C14H22Cl2N4O2 and a molecular weight of 349.26 g/mol. Its IUPAC name is tert-butyl N-[[2-chloro-5-(chloromethyl)pyrimidin-4-yl]-(2-methylpropyl)amino]carbamate.
| Compound Name | tert-butyl N-[[2-chloro-5-(chloromethyl)pyrimidin-4-yl]-(2-methylpropyl)amino]carbamate |
|---|---|
| PubChem CID | 46915218 |
| Molecular Formula | C14H22Cl2N4O2 |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | tert-butyl N-[[2-chloro-5-(chloromethyl)pyrimidin-4-yl]-(2-methylpropyl)amino]carbamate |
| SMILES | CC(C)CN(NC(=O)OC(C)(C)C)c1nc(Cl)ncc1CCl |
| InChI | InChI=1S/C14H22Cl2N4O2/c1-9(2)8-20(19-13(21)22-14(3,4)5)11-10(6-15)7-17-12(16)18-11/h7,9H,6,8H2,1-5H3,(H,19,21) |
| InChIKey | YSFUDEJZCMUOOG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|