C17H25ClN6O2 — CID 59290944
tert-butyl N-[(2-chloro-9-methylpurin-6-yl)-(cyclopentylmethyl)amino]carbamate (PubChem CID 59290944) has the molecular formula C17H25ClN6O2 and a molecular weight of 380.88 g/mol. Its IUPAC name is tert-butyl N-[(2-chloro-9-methylpurin-6-yl)-(cyclopentylmethyl)amino]carbamate.
| Compound Name | tert-butyl N-[(2-chloro-9-methylpurin-6-yl)-(cyclopentylmethyl)amino]carbamate |
|---|---|
| PubChem CID | 59290944 |
| Molecular Formula | C17H25ClN6O2 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | tert-butyl N-[(2-chloro-9-methylpurin-6-yl)-(cyclopentylmethyl)amino]carbamate |
| SMILES | Cn1cnc2c(N(CC3CCCC3)NC(=O)OC(C)(C)C)nc(Cl)nc21 |
| InChI | InChI=1S/C17H25ClN6O2/c1-17(2,3)26-16(25)22-24(9-11-7-5-6-8-11)14-12-13(20-15(18)21-14)23(4)10-19-12/h10-11H,5-9H2,1-4H3,(H,22,25) |
| InChIKey | NDYCWNQOTMDNDF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|