C23H35N7O2 — CID 70286781
tert-butyl N-[(2-cyano-9-heptan-2-ylpurin-6-yl)-cyclopentylamino]carbamate (PubChem CID 70286781) has the molecular formula C23H35N7O2 and a molecular weight of 441.58 g/mol. Its IUPAC name is tert-butyl N-[(2-cyano-9-heptan-2-ylpurin-6-yl)-cyclopentylamino]carbamate.
| Compound Name | tert-butyl N-[(2-cyano-9-heptan-2-ylpurin-6-yl)-cyclopentylamino]carbamate |
|---|---|
| PubChem CID | 70286781 |
| Molecular Formula | C23H35N7O2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.29 |
| IUPAC Name | tert-butyl N-[(2-cyano-9-heptan-2-ylpurin-6-yl)-cyclopentylamino]carbamate |
| SMILES | CCCCCC(C)n1cnc2c(N(NC(=O)OC(C)(C)C)C3CCCC3)nc(C#N)nc21 |
| InChI | InChI=1S/C23H35N7O2/c1-6-7-8-11-16(2)29-15-25-19-20(29)26-18(14-24)27-21(19)30(17-12-9-10-13-17)28-22(31)32-23(3,4)5/h15-17H,6-13H2,1-5H3,(H,28,31) |
| InChIKey | BXTWPECIEATWJY-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 108.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|