C23H37N9O3 — CID 70283023
tert-butyl N-[[2-amino-9-[4-(dimethylamino)piperidine-1-carbonyl]purin-6-yl]-cyclopentylamino]carbamate (PubChem CID 70283023) has the molecular formula C23H37N9O3 and a molecular weight of 487.61 g/mol. Its IUPAC name is tert-butyl N-[[2-amino-9-[4-(dimethylamino)piperidine-1-carbonyl]purin-6-yl]-cyclopentylamino]carbamate.
| Compound Name | tert-butyl N-[[2-amino-9-[4-(dimethylamino)piperidine-1-carbonyl]purin-6-yl]-cyclopentylamino]carbamate |
|---|---|
| PubChem CID | 70283023 |
| Molecular Formula | C23H37N9O3 |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.30 |
| IUPAC Name | tert-butyl N-[[2-amino-9-[4-(dimethylamino)piperidine-1-carbonyl]purin-6-yl]-cyclopentylamino]carbamate |
| SMILES | CN(C)C1CCN(C(=O)n2cnc3c(N(NC(=O)OC(C)(C)C)C4CCCC4)nc(N)nc32)CC1 |
| InChI | InChI=1S/C23H37N9O3/c1-23(2,3)35-21(33)28-32(16-8-6-7-9-16)19-17-18(26-20(24)27-19)31(14-25-17)22(34)30-12-10-15(11-13-30)29(4)5/h14-16H,6-13H2,1-5H3,(H,28,33)(H2,24,26,27) |
| InChIKey | SBXMDIWXDZYZQI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 134.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|