C27H40N10O — CID 70286825
N'-[2-amino-9-[2-(dimethylamino)ethyl]purin-6-yl]-N'-cyclopentyl-4-[(4-methylpiperazin-1-yl)methyl]benzohydrazide (PubChem CID 70286825) has the molecular formula C27H40N10O and a molecular weight of 520.69 g/mol. Its IUPAC name is N'-[2-amino-9-[2-(dimethylamino)ethyl]purin-6-yl]-N'-cyclopentyl-4-[(4-methylpiperazin-1-yl)methyl]benzohydrazide.
| Compound Name | N'-[2-amino-9-[2-(dimethylamino)ethyl]purin-6-yl]-N'-cyclopentyl-4-[(4-methylpiperazin-1-yl)methyl]benzohydrazide |
|---|---|
| PubChem CID | 70286825 |
| Molecular Formula | C27H40N10O |
| Molecular Weight | 520.69 g/mol |
| Exact Mass | 520.34 |
| IUPAC Name | N'-[2-amino-9-[2-(dimethylamino)ethyl]purin-6-yl]-N'-cyclopentyl-4-[(4-methylpiperazin-1-yl)methyl]benzohydrazide |
| SMILES | CN(C)CCn1cnc2c(N(NC(=O)c3ccc(CN4CCN(C)CC4)cc3)C3CCCC3)nc(N)nc21 |
| InChI | InChI=1S/C27H40N10O/c1-33(2)12-17-36-19-29-23-24(36)30-27(28)31-25(23)37(22-6-4-5-7-22)32-26(38)21-10-8-20(9-11-21)18-35-15-13-34(3)14-16-35/h8-11,19,22H,4-7,12-18H2,1-3H3,(H,32,38)(H2,28,30,31) |
| InChIKey | OVFFSAPQWWYTBU-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.69 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|