C29H35N9O — CID 71030091
N'-cyclopentyl-6-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-N'-(9-methylpurin-6-yl)pyridine-2-carbohydrazide (PubChem CID 71030091) has the molecular formula C29H35N9O and a molecular weight of 525.66 g/mol. Its IUPAC name is N'-cyclopentyl-6-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-N'-(9-methylpurin-6-yl)pyridine-2-carbohydrazide.
| Compound Name | N'-cyclopentyl-6-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-N'-(9-methylpurin-6-yl)pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 71030091 |
| Molecular Formula | C29H35N9O |
| Molecular Weight | 525.66 g/mol |
| Exact Mass | 525.30 |
| IUPAC Name | N'-cyclopentyl-6-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-N'-(9-methylpurin-6-yl)pyridine-2-carbohydrazide |
| SMILES | CN1CCN(Cc2ccc(-c3cccc(C(=O)NN(c4ncnc5c4ncn5C)C4CCCC4)n3)cc2)CC1 |
| InChI | InChI=1S/C29H35N9O/c1-35-14-16-37(17-15-35)18-21-10-12-22(13-11-21)24-8-5-9-25(33-24)29(39)34-38(23-6-3-4-7-23)28-26-27(30-19-31-28)36(2)20-32-26/h5,8-13,19-20,23H,3-4,6-7,14-18H2,1-2H3,(H,34,39) |
| InChIKey | DVHZRHYAIXBSPR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 95.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.66 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|