C30H41BN8O — CID 89258702
CID 89258702 (PubChem CID 89258702) has the molecular formula C30H41BN8O and a molecular weight of 540.53 g/mol.
| Compound Name | CID 89258702 |
|---|---|
| PubChem CID | 89258702 |
| Molecular Formula | C30H41BN8O |
| Molecular Weight | 540.53 g/mol |
| Exact Mass | 540.35 |
| IUPAC Name | — |
| SMILES | [B]c1cnc(C#N)nc1N(NC(=O)c1cccc(CN2CCN(CC3CCN(C)CC3)CC2)c1)C1CCCCC1 |
| InChI | InChI=1S/C30H41BN8O/c1-36-12-10-23(11-13-36)21-37-14-16-38(17-15-37)22-24-6-5-7-25(18-24)30(40)35-39(26-8-3-2-4-9-26)29-27(31)20-33-28(19-32)34-29/h5-7,18,20,23,26H,2-4,8-17,21-22H2,1H3,(H,35,40) |
| InChIKey | FABGWWZFLWPUBL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 91.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.53 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|