C26H28BrN7O — CID 46914194
N'-(5-bromo-2-cyanopyrimidin-4-yl)-4-[(4-methylpiperazin-1-yl)methyl]-N'-(2-phenylethyl)benzohydrazide (PubChem CID 46914194) has the molecular formula C26H28BrN7O and a molecular weight of 534.46 g/mol. Its IUPAC name is N'-(5-bromo-2-cyanopyrimidin-4-yl)-4-[(4-methylpiperazin-1-yl)methyl]-N'-(2-phenylethyl)benzohydrazide.
| Compound Name | N'-(5-bromo-2-cyanopyrimidin-4-yl)-4-[(4-methylpiperazin-1-yl)methyl]-N'-(2-phenylethyl)benzohydrazide |
|---|---|
| PubChem CID | 46914194 |
| Molecular Formula | C26H28BrN7O |
| Molecular Weight | 534.46 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | N'-(5-bromo-2-cyanopyrimidin-4-yl)-4-[(4-methylpiperazin-1-yl)methyl]-N'-(2-phenylethyl)benzohydrazide |
| SMILES | CN1CCN(Cc2ccc(C(=O)NN(CCc3ccccc3)c3nc(C#N)ncc3Br)cc2)CC1 |
| InChI | InChI=1S/C26H28BrN7O/c1-32-13-15-33(16-14-32)19-21-7-9-22(10-8-21)26(35)31-34(12-11-20-5-3-2-4-6-20)25-23(27)18-29-24(17-28)30-25/h2-10,18H,11-16,19H2,1H3,(H,31,35) |
| InChIKey | OYSAUWHOWQAYDO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 88.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|