C21H25ClN6O2 — CID 70316326
N'-(5-chloro-2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)-4-(morpholin-4-ylmethyl)benzohydrazide (PubChem CID 70316326) has the molecular formula C21H25ClN6O2 and a molecular weight of 428.92 g/mol. Its IUPAC name is N'-(5-chloro-2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)-4-(morpholin-4-ylmethyl)benzohydrazide.
| Compound Name | N'-(5-chloro-2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)-4-(morpholin-4-ylmethyl)benzohydrazide |
|---|---|
| PubChem CID | 70316326 |
| Molecular Formula | C21H25ClN6O2 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | N'-(5-chloro-2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)-4-(morpholin-4-ylmethyl)benzohydrazide |
| SMILES | CC(C)CN(NC(=O)c1ccc(CN2CCOCC2)cc1)c1nc(C#N)ncc1Cl |
| InChI | InChI=1S/C21H25ClN6O2/c1-15(2)13-28(20-18(22)12-24-19(11-23)25-20)26-21(29)17-5-3-16(4-6-17)14-27-7-9-30-10-8-27/h3-6,12,15H,7-10,13-14H2,1-2H3,(H,26,29) |
| InChIKey | RFVMQAZVVPTTKS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 94.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|