C23H26N6O — CID 70316671
N'-(2-cyano-5-ethenylpyrimidin-4-yl)-4-(2,5-dihydropyrrol-1-ylmethyl)-N'-(2-methylpropyl)benzohydrazide (PubChem CID 70316671) has the molecular formula C23H26N6O and a molecular weight of 402.50 g/mol. Its IUPAC name is N'-(2-cyano-5-ethenylpyrimidin-4-yl)-4-(2,5-dihydropyrrol-1-ylmethyl)-N'-(2-methylpropyl)benzohydrazide.
| Compound Name | N'-(2-cyano-5-ethenylpyrimidin-4-yl)-4-(2,5-dihydropyrrol-1-ylmethyl)-N'-(2-methylpropyl)benzohydrazide |
|---|---|
| PubChem CID | 70316671 |
| Molecular Formula | C23H26N6O |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | N'-(2-cyano-5-ethenylpyrimidin-4-yl)-4-(2,5-dihydropyrrol-1-ylmethyl)-N'-(2-methylpropyl)benzohydrazide |
| SMILES | C=Cc1cnc(C#N)nc1N(CC(C)C)NC(=O)c1ccc(CN2CC=CC2)cc1 |
| InChI | InChI=1S/C23H26N6O/c1-4-19-14-25-21(13-24)26-22(19)29(15-17(2)3)27-23(30)20-9-7-18(8-10-20)16-28-11-5-6-12-28/h4-10,14,17H,1,11-12,15-16H2,2-3H3,(H,27,30) |
| InChIKey | HBDMIFSFMOMYNZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|