C22H27ClN6O — CID 143419515
N'-(5-chloro-2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)-4-[(3-methylpyrrolidin-1-yl)methyl]benzohydrazide (PubChem CID 143419515) has the molecular formula C22H27ClN6O and a molecular weight of 426.95 g/mol. Its IUPAC name is N'-(5-chloro-2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)-4-[(3-methylpyrrolidin-1-yl)methyl]benzohydrazide.
| Compound Name | N'-(5-chloro-2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)-4-[(3-methylpyrrolidin-1-yl)methyl]benzohydrazide |
|---|---|
| PubChem CID | 143419515 |
| Molecular Formula | C22H27ClN6O |
| Molecular Weight | 426.95 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | N'-(5-chloro-2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)-4-[(3-methylpyrrolidin-1-yl)methyl]benzohydrazide |
| SMILES | CC(C)CN(NC(=O)c1ccc(CN2CCC(C)C2)cc1)c1nc(C#N)ncc1Cl |
| InChI | InChI=1S/C22H27ClN6O/c1-15(2)12-29(21-19(23)11-25-20(10-24)26-21)27-22(30)18-6-4-17(5-7-18)14-28-9-8-16(3)13-28/h4-7,11,15-16H,8-9,12-14H2,1-3H3,(H,27,30) |
| InChIKey | OFNSCQHZRYKELJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.95 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|