C14H20BrN5O2 — CID 46915373
tert-butyl N-[(5-bromo-2-cyanopyrimidin-4-yl)-butylamino]carbamate (PubChem CID 46915373) has the molecular formula C14H20BrN5O2 and a molecular weight of 370.25 g/mol. Its IUPAC name is tert-butyl N-[(5-bromo-2-cyanopyrimidin-4-yl)-butylamino]carbamate.
| Compound Name | tert-butyl N-[(5-bromo-2-cyanopyrimidin-4-yl)-butylamino]carbamate |
|---|---|
| PubChem CID | 46915373 |
| Molecular Formula | C14H20BrN5O2 |
| Molecular Weight | 370.25 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | tert-butyl N-[(5-bromo-2-cyanopyrimidin-4-yl)-butylamino]carbamate |
| SMILES | CCCCN(NC(=O)OC(C)(C)C)c1nc(C#N)ncc1Br |
| InChI | InChI=1S/C14H20BrN5O2/c1-5-6-7-20(19-13(21)22-14(2,3)4)12-10(15)9-17-11(8-16)18-12/h9H,5-7H2,1-4H3,(H,19,21) |
| InChIKey | QJDCZKVNIZTULM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.25 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|