C10H12BrN5O2 — CID 143664026
tert-butyl N-[(5-bromo-2-cyanopyrimidin-4-yl)amino]carbamate (PubChem CID 143664026) has the molecular formula C10H12BrN5O2 and a molecular weight of 314.14 g/mol. Its IUPAC name is tert-butyl N-[(5-bromo-2-cyanopyrimidin-4-yl)amino]carbamate.
| Compound Name | tert-butyl N-[(5-bromo-2-cyanopyrimidin-4-yl)amino]carbamate |
|---|---|
| PubChem CID | 143664026 |
| Molecular Formula | C10H12BrN5O2 |
| Molecular Weight | 314.14 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | tert-butyl N-[(5-bromo-2-cyanopyrimidin-4-yl)amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNc1nc(C#N)ncc1Br |
| InChI | InChI=1S/C10H12BrN5O2/c1-10(2,3)18-9(17)16-15-8-6(11)5-13-7(4-12)14-8/h5H,1-3H3,(H,16,17)(H,13,14,15) |
| InChIKey | PHHATCXMNOUXHV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.14 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|