C18H23FN2O9 — CID 169193372
dimethyl (2S,4S)-2-(2-fluoro-6-nitrophenoxy)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate (PubChem CID 169193372) has the molecular formula C18H23FN2O9 and a molecular weight of 430.39 g/mol. Its IUPAC name is dimethyl (2S,4S)-2-(2-fluoro-6-nitrophenoxy)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate.
| Compound Name | dimethyl (2S,4S)-2-(2-fluoro-6-nitrophenoxy)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
|---|---|
| PubChem CID | 169193372 |
| Molecular Formula | C18H23FN2O9 |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | dimethyl (2S,4S)-2-(2-fluoro-6-nitrophenoxy)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
| SMILES | COC(=O)[C@H](C[C@H](Oc1c(F)cccc1[N+](=O)[O-])C(=O)OC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H23FN2O9/c1-18(2,3)30-17(24)20-11(15(22)27-4)9-13(16(23)28-5)29-14-10(19)7-6-8-12(14)21(25)26/h6-8,11,13H,9H2,1-5H3,(H,20,24)/t11-,13-/m0/s1 |
| InChIKey | QUJQWXCNBYNXHP-AAEUAGOBSA-N |
| XLogP | 2.11 |
| TPSA | 143.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|