C9H9ClN6O3 — CID 88591730
2-chloro-5-nitro-N-[(1R)-1-(1,3,4-oxadiazol-2-yl)propyl]pyrimidin-4-amine (PubChem CID 88591730) has the molecular formula C9H9ClN6O3 and a molecular weight of 284.66 g/mol. Its IUPAC name is 2-chloro-5-nitro-N-[(1R)-1-(1,3,4-oxadiazol-2-yl)propyl]pyrimidin-4-amine.
| Compound Name | 2-chloro-5-nitro-N-[(1R)-1-(1,3,4-oxadiazol-2-yl)propyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 88591730 |
| Molecular Formula | C9H9ClN6O3 |
| Molecular Weight | 284.66 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 2-chloro-5-nitro-N-[(1R)-1-(1,3,4-oxadiazol-2-yl)propyl]pyrimidin-4-amine |
| SMILES | CC[C@@H](Nc1nc(Cl)ncc1[N+](=O)[O-])c1nnco1 |
| InChI | InChI=1S/C9H9ClN6O3/c1-2-5(8-15-12-4-19-8)13-7-6(16(17)18)3-11-9(10)14-7/h3-5H,2H2,1H3,(H,11,13,14)/t5-/m1/s1 |
| InChIKey | CFIPYWFAHYLKAR-RXMQYKEDSA-N |
| XLogP | 1.98 |
| TPSA | 119.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.66 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|