C8H3Cl2N3O3 — CID 175866851
6,7-dichloro-3-nitro-1H-1,8-naphthyridin-4-one (PubChem CID 175866851) has the molecular formula C8H3Cl2N3O3 and a molecular weight of 260.04 g/mol. Its IUPAC name is 6,7-dichloro-3-nitro-1H-1,8-naphthyridin-4-one.
| Compound Name | 6,7-dichloro-3-nitro-1H-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 175866851 |
| Molecular Formula | C8H3Cl2N3O3 |
| Molecular Weight | 260.04 g/mol |
| Exact Mass | 258.96 |
| IUPAC Name | 6,7-dichloro-3-nitro-1H-1,8-naphthyridin-4-one |
| SMILES | O=c1c([N+](=O)[O-])c[nH]c2nc(Cl)c(Cl)cc12 |
| InChI | InChI=1S/C8H3Cl2N3O3/c9-4-1-3-6(14)5(13(15)16)2-11-8(3)12-7(4)10/h1-2H,(H,11,12,14) |
| InChIKey | BKKYCKUPMBUBGU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 88.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.04 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|