C11H5BrClF3N2O4 — CID 175506359
7-bromo-6-chloro-3-nitro-8-(1,2,2-trifluoroethoxy)-1H-quinolin-4-one (PubChem CID 175506359) has the molecular formula C11H5BrClF3N2O4 and a molecular weight of 401.52 g/mol. Its IUPAC name is 7-bromo-6-chloro-3-nitro-8-(1,2,2-trifluoroethoxy)-1H-quinolin-4-one.
| Compound Name | 7-bromo-6-chloro-3-nitro-8-(1,2,2-trifluoroethoxy)-1H-quinolin-4-one |
|---|---|
| PubChem CID | 175506359 |
| Molecular Formula | C11H5BrClF3N2O4 |
| Molecular Weight | 401.52 g/mol |
| Exact Mass | 399.91 |
| IUPAC Name | 7-bromo-6-chloro-3-nitro-8-(1,2,2-trifluoroethoxy)-1H-quinolin-4-one |
| SMILES | O=c1c([N+](=O)[O-])c[nH]c2c(OC(F)C(F)F)c(Br)c(Cl)cc12 |
| InChI | InChI=1S/C11H5BrClF3N2O4/c12-6-4(13)1-3-7(9(6)22-11(16)10(14)15)17-2-5(8(3)19)18(20)21/h1-2,10-11H,(H,17,19) |
| InChIKey | MAEMDMZPJOBUGR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|