C9H6ClN3O3 — CID 130062797
1-(6-chloro-4-nitro-1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone (PubChem CID 130062797) has the molecular formula C9H6ClN3O3 and a molecular weight of 239.62 g/mol. Its IUPAC name is 1-(6-chloro-4-nitro-1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone.
| Compound Name | 1-(6-chloro-4-nitro-1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone |
|---|---|
| PubChem CID | 130062797 |
| Molecular Formula | C9H6ClN3O3 |
| Molecular Weight | 239.62 g/mol |
| Exact Mass | 239.01 |
| IUPAC Name | 1-(6-chloro-4-nitro-1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone |
| SMILES | CC(=O)c1c[nH]c2nc(Cl)cc([N+](=O)[O-])c12 |
| InChI | InChI=1S/C9H6ClN3O3/c1-4(14)5-3-11-9-8(5)6(13(15)16)2-7(10)12-9/h2-3H,1H3,(H,11,12) |
| InChIKey | UVUANAKRWZRZBC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 88.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.62 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|