C9H9N3O — CID 123135068
1-(4-amino-1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone (PubChem CID 123135068) has the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. Its IUPAC name is 1-(4-amino-1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone.
| Compound Name | 1-(4-amino-1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone |
|---|---|
| PubChem CID | 123135068 |
| Molecular Formula | C9H9N3O |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | 1-(4-amino-1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone |
| SMILES | CC(=O)c1c[nH]c2nccc(N)c12 |
| InChI | InChI=1S/C9H9N3O/c1-5(13)6-4-12-9-8(6)7(10)2-3-11-9/h2-4H,1H3,(H3,10,11,12) |
| InChIKey | NVWUCURTDZWQBC-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |