C11H12N2O2 — CID 24801189
1-(4-ethoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone (PubChem CID 24801189) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 1-(4-ethoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone.
| Compound Name | 1-(4-ethoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone |
|---|---|
| PubChem CID | 24801189 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 1-(4-ethoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone |
| SMILES | CCOc1ccnc2[nH]cc(C(C)=O)c12 |
| InChI | InChI=1S/C11H12N2O2/c1-3-15-9-4-5-12-11-10(9)8(6-13-11)7(2)14/h4-6H,3H2,1-2H3,(H,12,13) |
| InChIKey | ABERHZYRGVPCBN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |