C6H3ClN4O2 — CID 5375533
5-chloro-7-nitro-1H-imidazo[4,5-b]pyridine (PubChem CID 5375533) has the molecular formula C6H3ClN4O2 and a molecular weight of 198.57 g/mol. Its IUPAC name is 5-chloro-7-nitro-1H-imidazo[4,5-b]pyridine.
| Compound Name | 5-chloro-7-nitro-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 5375533 |
| Molecular Formula | C6H3ClN4O2 |
| Molecular Weight | 198.57 g/mol |
| Exact Mass | 197.99 |
| IUPAC Name | 5-chloro-7-nitro-1H-imidazo[4,5-b]pyridine |
| SMILES | O=[N+]([O-])c1cc(Cl)nc2nc[nH]c12 |
| InChI | InChI=1S/C6H3ClN4O2/c7-4-1-3(11(12)13)5-6(10-4)9-2-8-5/h1-2H,(H,8,9,10) |
| InChIKey | IWQHZTCGVPZMSR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.57 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|